For research use only. Not for therapeutic Use.
(R)-(+)-Felodipine-d5(Cat No.:R008880)is a deuterated compound featuring five deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of (R)-(+)-Felodipine is crucial for studying its pharmacokinetics, metabolic pathways, and drug interactions as a calcium channel blocker. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for mass spectrometry and NMR applications. With enhanced stability and consistency, (R)-(+)-Felodipine-d5 integrates seamlessly into various experimental setups, providing a robust solution for high-precision scientific investigations.
Catalog Number | R008880 |
CAS Number | 1217716-73-8 |
Synonyms | (4R)-4-(2,3-Dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic Acid 3-Ethyl-d5 5-Methyl Ester; (+)-Felodipine-d5; (R)-Felodipine-d5; |
Molecular Formula | C18H19Cl2NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-O-methyl 5-O-(1,1,2,2,2-pentadeuterioethyl) (4S)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3/t15-/m0/s1/i1D3,5D2 |
InChIKey | RZTAMFZIAATZDJ-SAFFEWCNSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C1=C(NC(=C([C@@H]1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |