For research use only. Not for therapeutic Use.
(R)-(-)-Ibuprofen-d3(Cat No.:S000319) is a deuterated version of (R)-(-)-Ibuprofen, where three hydrogen atoms are replaced with deuterium. (R)-(-)-Ibuprofen is the active enantiomer of ibuprofen, a widely used nonsteroidal anti-inflammatory drug (NSAID) that helps reduce inflammation, pain, and fever. The introduction of deuterium enhances the molecular stability of ibuprofen, allowing for more precise and detailed pharmacokinetic and metabolic studies.
Catalog Number | S000319 |
CAS Number | 121702-86-1 |
Molecular Formula | C13H15D3O2 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | (2R)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid |
InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1/i3D3 |
InChIKey | HEFNNWSXXWATRW-NYJKMMONSA-N |
SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |