For research use only. Not for therapeutic Use.
(R)-Irsenontrine ((R)-E2027), the R-enantiomer of Irsenontrine (HY-132821), is a potent phosphodiesterase 9 (PDE9) inhibitor with an IC50 value of 0.041 μM. (R)-Irsenontrine can be used for the research of neurological diseases[1].
| Catalog Number | I042765 |
| CAS Number | 1429509-81-8 |
| Synonyms | 7-(2-methoxy-3,5-dimethylpyridin-4-yl)-1-[(3R)-oxolan-3-yl]-5H-pyrazolo[4,3-c]quinolin-4-one |
| Molecular Formula | C22H22N4O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H22N4O3/c1-12-9-23-22(28-3)13(2)19(12)14-4-5-16-18(8-14)25-21(27)17-10-24-26(20(16)17)15-6-7-29-11-15/h4-5,8-10,15H,6-7,11H2,1-3H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | CKJDCNZBABIEBZ-OAHLLOKOSA-N |
| SMILES | CC1=CN=C(C(=C1C2=CC3=C(C=C2)C4=C(C=NN4C5CCOC5)C(=O)N3)C)OC |
| Reference | [1]. Yoshihiko N, et, al. Pyrazoloquinoline derivative. WO2013051639A1. |
