For research use only. Not for therapeutic Use.
(R)-Ketorolac is the enantiomer of the nonsteroidal anti-inflammatory drug (NSAID) ketorolac, used in pharmaceutical research to study its specific pharmacological effects. It is essential for understanding the stereoselective mechanisms of action, pharmacokinetics, and therapeutic efficacy of ketorolac. This compound aids in developing safer and more effective pain management treatments. Researchers rely on (R)-Ketorolac for precise and reliable results in advanced analgesic research and drug development, contributing significantly to innovations in pain relief therapies.
| Catalog Number | R011270 |
| CAS Number | 66635-93-6 |
| Synonyms | (1R)-5-Benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic Acid; (+)-Ketorolac; R-(+)-Ketorolac; |
| Molecular Formula | C15H13NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (1R)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| InChI | InChI=1S/C15H13NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13/h1-7,11H,8-9H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | OZWKMVRBQXNZKK-LLVKDONJSA-N |
| SMILES | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1C(=O)O |
