For research use only. Not for therapeutic Use.
(R)-Lisofylline is a chiral derivative of pentoxifylline, used in pharmaceutical and biochemical research. Known for its anti-inflammatory and cytoprotective properties, it is essential for studying its therapeutic potential in treating inflammatory diseases and immune disorders. This compound aids in understanding the stereoselective mechanisms of action and optimizing its pharmacological effects. Researchers rely on (R)-Lisofylline for precise and reliable results in advanced drug development, immunology, and inflammation research, contributing significantly to innovations in therapeutic interventions and medical treatments.
| Catalog Number | R008963 |
| CAS Number | 100324-81-0 |
| Synonyms | 3,7-Dihydro-1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-1H-purine-2,6-dione; CT 1501R; ?Lisophylline; ProTec;? |
| Molecular Formula | C13H20N4O3 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-[(5R)-5-hydroxyhexyl]-3,7-dimethylpurine-2,6-dione |
| InChI | InChI=1S/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | NSMXQKNUPPXBRG-SECBINFHSA-N |
| SMILES | CC(CCCCN1C(=O)C2=C(N=CN2C)N(C1=O)C)O |
