For research use only. Not for therapeutic Use.
(R)-M8891 (compound R-9) is a less active isomer of M8891. M8891 is an orally active, reversible and brain penetrant Methionine Aminopeptidase-2 (MetAP-2) inhibitor[1].
| Catalog Number | I045315 |
| CAS Number | 2575547-29-2 |
| Synonyms | (3R)-N-[(3,5-difluorophenyl)methyl]-3-hydroxy-1-(1H-indol-5-yl)-2-oxopyrrolidine-3-carboxamide |
| Molecular Formula | C20H17F2N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H17F2N3O3/c21-14-7-12(8-15(22)10-14)11-24-18(26)20(28)4-6-25(19(20)27)16-1-2-17-13(9-16)3-5-23-17/h1-3,5,7-10,23,28H,4,6,11H2,(H,24,26)/t20-/m1/s1 |
| InChIKey | WVGGJQVCOTYFPV-HXUWFJFHSA-N |
| SMILES | C1CN(C(=O)C1(C(=O)NCC2=CC(=CC(=C2)F)F)O)C3=CC4=C(C=C3)NC=C4 |
| Reference | [1]. Timo Heinrich, et al. Process for manufacturing (s)-3-hydroxy-1-(1h-indol-5-yl)-2-oxo-pyrrolidine-3-carboxylic acid 3,5-difluoro-benzylamide. WO2021001328A1. |
