Home
>
Chemical Reagents>Heterocyclic Building Blocks> (R)-Methyl 2-(1-((2-amino-5-bromopyridin-3-yl)oxy)ethyl)-4-fluorobenzoate
For research use only. Not for therapeutic Use.
(R)-Methyl 2-(1-((2-amino-5-bromopyridin-3-yl)oxy)ethyl)-4-fluorobenzoate(Cat No.:L007222), is a chemical compound. It features a fluorobenzoate group—a benzoic acid derivative with a fluorine atom at the 4th position—substituted with an oxyethyl chain containing an amino group at the 2nd position and a bromopyridinyl group at the 5th position. This compound is significant in medicinal chemistry and drug discovery research. Its complex structure suggests potential interactions with biological targets, making it valuable for researchers exploring new bioactive molecules. The compound’s unique structure provides opportunities for designing novel pharmaceuticals, contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 1454848-00-0 |
Molecular Formula | C15H14BrFN2O3 |
Purity | ≥95% |
IUPAC Name | methyl 2-[(1R)-1-(2-amino-5-bromopyridin-3-yl)oxyethyl]-4-fluorobenzoate |
InChI | InChI=1S/C15H14BrFN2O3/c1-8(22-13-5-9(16)7-19-14(13)18)12-6-10(17)3-4-11(12)15(20)21-2/h3-8H,1-2H3,(H2,18,19)/t8-/m1/s1 |
InChIKey | NEXBDDSPNVIGGI-MRVPVSSYSA-N |
SMILES | CC(C1=C(C=CC(=C1)F)C(=O)OC)OC2=C(N=CC(=C2)Br)N |