Home
>
Chemical Reagents>Heterocyclic Building Blocks> (R)-methyl 4-(pyrrolidin-2-yl)benzoate hydrochloride
For research use only. Not for therapeutic Use.
(R)-methyl 4-(pyrrolidin-2-yl)benzoate hydrochloride(CAT: L000139) is a compound with significant applications in organic chemistry and pharmaceutical research. Its action mechanism involves participating in various chemical reactions, making it a valuable intermediate for the synthesis of complex molecules. In pharmaceutical research, it plays a crucial role in the development of pharmaceutical agents, particularly in the fields of central nervous system and psychiatric medications.
CAS Number | 1381927-79-2 |
Molecular Formula | C12H16ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 4-[(2R)-pyrrolidin-2-yl]benzoate;hydrochloride |
InChI | InChI=1S/C12H15NO2.ClH/c1-15-12(14)10-6-4-9(5-7-10)11-3-2-8-13-11;/h4-7,11,13H,2-3,8H2,1H3;1H/t11-;/m1./s1 |
InChIKey | HXDSVQMGMNSYNW-RFVHGSKJSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |