For research use only. Not for therapeutic Use.
(R)-ML375 (Cat No.: I040089) is a selective small-molecule inhibitor primarily studied for its potential applications in cancer and neurodegenerative disease research. It targets specific enzymes or receptors involved in cellular processes such as proliferation, apoptosis, or protein aggregation. As a chiral compound, the (R)-enantiomer of ML375 has demonstrated higher potency and specificity compared to other variants, making it a valuable tool for understanding the molecular mechanisms of disease. Research suggests it could provide therapeutic benefits in diseases like cancer or Alzheimer’s, but further studies are needed.
| CAS Number | 1488362-56-6 |
| Synonyms | (9bR)-9b-(4-chlorophenyl)-1-(3,4-difluorobenzoyl)-2,3-dihydroimidazo[2,1-a]isoindol-5-one |
| Molecular Formula | C23H15ClF2N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H15ClF2N2O2/c24-16-8-6-15(7-9-16)23-18-4-2-1-3-17(18)22(30)28(23)12-11-27(23)21(29)14-5-10-19(25)20(26)13-14/h1-10,13H,11-12H2/t23-/m1/s1 |
| InChIKey | GXBAKXRLQAPKEE-HSZRJFAPSA-N |
| SMILES | C1CN(C2(N1C(=O)C3=CC=CC=C32)C4=CC=C(C=C4)Cl)C(=O)C5=CC(=C(C=C5)F)F |
| Reference | [1]. Patrick R Gentry, et al. Discovery of the first M5-selective and CNS penetrant negative allosteric modulator (NAM) of a muscarinic acetylcholine receptor: (S)-9b-(4-chlorophenyl)-1-(3,4-difluorobenzoyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5(9bH)-one (ML375). J Med Chem. 2013 Nov 27;56(22):9351-5. |
