(R)-Neotame-d3（Cat No.:S001143） is a deuterated version of (R)-Neotame, with three hydrogen atoms replaced by deuterium. This isotopic enhancement significantly increases its stability and makes it an essential analytical tool for studying the metabolism and degradation pathways of Neotame, a potent artificial sweetener. Utilized predominantly in food chemistry and safety evaluations, (R)-Neotame-d3 aids in tracing the absorption and distribution of Neotame in biological systems. Its reliable isotopic labeling provides accurate, sensitive detection in mass spectrometry, crucial for regulatory compliance and ensuring consumer safety in food products.
| Catalog Number | S001143 |
| Molecular Formula | C20H27D3N2O5 |
| Purity | ≥95% |
| IUPAC Name | (3R)-3-(3,3-dimethylbutylamino)-4-oxo-4-[[(2S)-1-oxo-3-phenyl-1-(trideuteriomethoxy)propan-2-yl]amino]butanoic acid |
| InChI | InChI=1S/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16+/m1/s1/i4D3 |
| InChIKey | HLIAVLHNDJUHFG-RYPTXDJRSA-N |
| SMILES | CC(C)(C)CCNC(CC(=O)O)C(=O)NC(CC1=CC=CC=C1)C(=O)OC |
-Neotame-d3.gif)