For research use only. Not for therapeutic Use.
R-(+)-Nicotine (CAT: R001717) is the naturally occurring enantiomer of nicotine, a potent alkaloid found in tobacco plants. This compound has well-established psychoactive properties due to its ability to bind to nicotinic acetylcholine receptors in the central nervous system, leading to the release of neurotransmitters like dopamine. As a result, it induces feelings of alertness and pleasure, making it a highly addictive substance.
CAS Number | 25162-00-9 |
Synonyms | 3-[(2R)-1-Methyl-2-pyrrolidinyl]pyridine; 2’βH-Nicotine; (R)-3-(1-Methyl-2-pyrrolidinyl)?pyridine; (+)-(R)-Nicotine; (+)-Nicotine; (R)-3-(1-Methylpyrrolidin-2-yl)pyridine; (R)-Nicotine; D-(+)-Nicotine; D-Nicotine; Pseudonicotine; d-Nicotine; ? |
Molecular Formula | C10H14N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-[(2R)-1-methylpyrrolidin-2-yl]pyridine |
InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m1/s1 |
InChIKey | SNICXCGAKADSCV-SNVBAGLBSA-N |
SMILES | CN1CCCC1C2=CN=CC=C2 |