For research use only. Not for therapeutic Use.
(R)-o-Methyl-a-phenethylamine(Cat No.:M009418) is a chiral organic compound featuring a phenethylamine backbone with an ortho-methyl substitution on the aromatic ring. The “(R)” prefix indicates that the molecule has a specific stereochemistry, or spatial arrangement of atoms, which is crucial for its biological activity. This compound is structurally related to neurotransmitters and psychoactive substances, and as such, it may interact with the body’s central nervous system. Its applications could include research into neurological processes, drug development, and as a building block in organic synthesis, particularly for compounds targeting receptor specificity and activity.
CAS Number | 105615-45-0 |
Molecular Formula | C9H13N |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (1R)-1-(2-methylphenyl)ethanamine |
InChI | InChI=1S/C9H13N/c1-7-5-3-4-6-9(7)8(2)10/h3-6,8H,10H2,1-2H3/t8-/m1/s1 |
InChIKey | ZCDYTNZJBGSKFI-MRVPVSSYSA-N |
SMILES | CC1=CC=CC=C1C(C)N |