For research use only. Not for therapeutic Use.
(R)-Phenotropil(CAT: I012896) is a potent nootropic compound, a derivative of piracetam, known for its cognitive-enhancing effects. The (R)-enantiomer is specifically recognized for its ability to improve memory, focus, and mental clarity. It works by modulating neurotransmitter systems, particularly increasing the activity of acetylcholine and dopamine, which are essential for cognitive functions. Due to its phenyl group, (R)-Phenotropil has enhanced lipophilicity, allowing it to cross the blood-brain barrier more effectively, resulting in quicker and more potent effects. It is also explored for its potential to reduce fatigue and enhance physical performance, making it of interest in both cognitive and physical performance research.
CAS Number | 949925-07-9 |
Synonyms | (R)-Phenylpiracetam; MRZ-9547; (4R)-2-(2-oxo-4-phenylpyrrolidin-1-yl)acetamide, 4(R)-Phenyl-2-pyrrolidone-1-acetamide |
Molecular Formula | C12H14N2O2 |
Purity | ≥95% |
IUPAC Name | 2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetamide |
InChI | InChI=1S/C12H14N2O2/c13-11(15)8-14-7-10(6-12(14)16)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,13,15)/t10-/m0/s1 |
InChIKey | LYONXVJRBWWGQO-JTQLQIEISA-N |
SMILES | C1C(CN(C1=O)CC(=O)N)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |