For research use only. Not for therapeutic Use.
(R)-Praziquantel (Cat.No:I012895) is the enantiomerically pure form of the anthelmintic drug praziquantel. It is widely used in the treatment of parasitic infections caused by flatworms, such as schistosomiasis and various tapeworm infections. (R)-Praziquantel works by disrupting the worm’s integrity, leading to paralysis and expulsion from the host.
CAS Number | 57452-98-9 |
Synonyms | (R)-PZQ; (-)-Praziquantel; (11bR)-2-(Cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
Molecular Formula | C19H24N2O2 |
Purity | ≥95% |
IUPAC Name | (11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
InChI | InChI=1S/C19H24N2O2/c22-18-13-20(19(23)15-7-2-1-3-8-15)12-17-16-9-5-4-6-14(16)10-11-21(17)18/h4-6,9,15,17H,1-3,7-8,10-13H2/t17-/m0/s1 |
InChIKey | FSVJFNAIGNNGKK-KRWDZBQOSA-N |
SMILES | C1CCC(CC1)C(=O)N2CC3C4=CC=CC=C4CCN3C(=O)C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |