For research use only. Not for therapeutic Use.
(R)-Preclamol hydrochloride（Cat No.:I041327）is the enantiomer of Preclamol hydrochloride, a compound studied for its potential use in managing preeclampsia, a pregnancy-related disorder marked by high blood pressure. The (R)-isomer is explored for its specific biological activity, particularly its ability to act as a vasodilator, helping to reduce elevated blood pressure and improve blood circulation to vital organs, including the placenta. Research focuses on its safety, efficacy, and potential therapeutic benefits, with ongoing studies to assess its suitability as a treatment for preeclampsia and related complications during pregnancy.
| CAS Number | 89874-80-6 |
| Synonyms | 3-[(3R)-1-propylpiperidin-3-yl]phenol;hydrochloride |
| Molecular Formula | C14H22ClNO |
| Purity | ≥95% |
| IUPAC Name | 3-[(3R)-1-propylpiperidin-3-yl]phenol;hydrochloride |
| InChI | InChI=1S/C14H21NO.ClH/c1-2-8-15-9-4-6-13(11-15)12-5-3-7-14(16)10-12;/h3,5,7,10,13,16H,2,4,6,8-9,11H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | NRHUDETYKUBQJT-ZOWNYOTGSA-N |
| SMILES | CCCN1CCC[C@@H](C1)C2=CC(=CC=C2)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
