For research use only. Not for therapeutic Use.
(R)-Propafenone is a chiral form of the antiarrhythmic drug propafenone, used in pharmaceutical research to study its specific pharmacological effects. It is essential for understanding the stereoselective mechanisms of action, pharmacokinetics, and therapeutic efficacy of propafenone. This compound aids in developing safer and more effective treatments for cardiac arrhythmias. Researchers rely on (R)-Propafenone for precise and reliable results in advanced cardiology research and drug development, contributing significantly to innovations in heart rhythm disorder therapies.
| CAS Number | 107381-31-7 |
| Synonyms | 1-[2-[(2R)-2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenyl-1-propanone; ?(+)-(R)-Propafenone; (+)-Propafenone; |
| Molecular Formula | C21H27NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-[2-[(2R)-2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one |
| InChI | InChI=1S/C21H27NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-11,18,22-23H,2,12-16H2,1H3/t18-/m1/s1 |
| InChIKey | JWHAUXFOSRPERK-GOSISDBHSA-N |
| SMILES | CCCNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
