For research use only. Not for therapeutic Use.
(R)-Tegoprazan (example 3), a benzimidazole derivative, is a potent kidney H+/K+-ATPase inhibitor with an IC50 of 98 nM of canine kidney Na+/K+-ATPase. (R)-Tegoprazan has the potential for gastrointestinal diseases research[1].
| Catalog Number | I041690 |
| CAS Number | 942195-56-4 |
| Synonyms | 7-[[(4R)-5,7-difluoro-3,4-dihydro-2H-chromen-4-yl]oxy]-N,N,2-trimethyl-3H-benzimidazole-5-carboxamide |
| Molecular Formula | C20H19F2N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H19F2N3O3/c1-10-23-14-6-11(20(26)25(2)3)7-17(19(14)24-10)28-15-4-5-27-16-9-12(21)8-13(22)18(15)16/h6-9,15H,4-5H2,1-3H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | CLIQCDHNPDMGSL-OAHLLOKOSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2OC3CCOC4=C3C(=CC(=C4)F)F)C(=O)N(C)C |
| Reference | [1]. Takeshi Hanazawa, et al. Chromane Substituted Benzimidazole Derivatives. US20070142448A1. |
