For research use only. Not for therapeutic Use.
(R)-tert-Butyl (1-(2-nitrophenyl)ethyl)carbamate (Cat.No:L003870) is a crucial compound in pharmaceutical research. Its chiral nature and nitrophenyl motif confer unique reactivity and pharmacological potential. This compound serves as a valuable building block in the synthesis of bioactive molecules, with applications in drug development.
CAS Number | 2411591-10-9 |
Molecular Formula | C13H18N2O4 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-[(1R)-1-(2-nitrophenyl)ethyl]carbamate |
InChI | InChI=1S/C13H18N2O4/c1-9(14-12(16)19-13(2,3)4)10-7-5-6-8-11(10)15(17)18/h5-9H,1-4H3,(H,14,16)/t9-/m1/s1 |
InChIKey | FWSARODNIFWDLV-SECBINFHSA-N |
SMILES | C[C@H](C1=CC=CC=C1[N+](=O)[O-])NC(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |