For research use only. Not for therapeutic Use.
(R)-Tetrahydrofuran-3-yl 4-methylbenzenesulfonate(Cat No.:L006833), is a chiral organic compound used in organic synthesis and asymmetric catalysis. Its molecular structure includes a tetrahydrofuran ring, a methyl group, and a benzenesulfonate ester moiety. This compound plays a crucial role in the preparation of various enantiopure molecules with pharmaceutical and agrochemical applications. Chemists utilize it as a substrate in asymmetric transformations to generate chiral building blocks for drug discovery and development.
CAS Number | 219823-47-9 |
Molecular Formula | C11H14O4S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | [(3R)-oxolan-3-yl] 4-methylbenzenesulfonate |
InChI | InChI=1S/C11H14O4S/c1-9-2-4-11(5-3-9)16(12,13)15-10-6-7-14-8-10/h2-5,10H,6-8H2,1H3/t10-/m1/s1 |
InChIKey | WWCNXHYRAKUQDB-SNVBAGLBSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCOC2 |