For research use only. Not for therapeutic Use.
R162 (CAT: I012082) is a selective inhibitor of Glutamate Dehydrogenase 1 (GDH1), an enzyme that is upregulated in human cancers. R162 demonstrates cell permeability and non-toxicity. It exhibits a Ki value of 28.6 µM for GDH1 and shows selectivity over other NADPH-dependent enzymes such as 6-phosphogluconate dehydrogenase (6PGD) and Fumarate hydratase (FH). R162 reduces intracellular fumarate levels, decreases Glutathione peroxidase (GPx) activity, and increases mitochondrial ROS levels. In preclinical studies, R162 has shown efficacy in inhibiting tumor growth and suppressing cancer cell proliferation in H1299 cells and primary leukemia cells.
| Catalog Number | I012082 |
| CAS Number | 64302-87-0 |
| Synonyms | 1-Hydroxy-2-(2-propen-1-yl)-9,10-anthracenedione |
| Molecular Formula | C₁₇H₁₂O₃ |
| Purity | ≥95% |
| Target | A Glutamate Dehydrogenase 1 (GDH1) inhibitor |
| Solubility | DMSO (>10 mg/ml) |
| Storage | -20°C |
| InChI | InChI=1S/C17H12O3/c1-2-5-10-8-9-13-14(15(10)18)17(20)12-7-4-3-6-11(12)16(13)19/h2-4,6-9,18H,1,5H2 |
| InChIKey | IMUBGIOLZQTIGI-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(C=CC=C2)C(C3=CC=C(CC=C)C(O)=C13)=O |
