For research use only. Not for therapeutic Use.
R406(Cat No.:I005039)is a potent and selective inhibitor of spleen tyrosine kinase (Syk), a crucial enzyme in immune cell signaling. By inhibiting Syk, R406 disrupts downstream signaling pathways, including those involved in B-cell receptor (BCR) and Fc receptor-mediated activation, thereby reducing inflammatory cytokine production and immune cell proliferation. R406 is widely used in research on autoimmune diseases, such as rheumatoid arthritis and systemic lupus erythematosus, where excessive immune responses play a role. It is also valuable for studying the modulation of immune responses and potential therapeutic strategies targeting Syk.
CAS Number | 841290-81-1 |
Synonyms | benzenesulfonic acid;6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
Molecular Formula | C22H23FN6O5.C6H6O3S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 61 mg/mL |
Storage | 3 years -20C powder |
IC50 | 41 nM |
IUPAC Name | benzenesulfonic acid;6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
InChI | InChI=1S/C22H23FN6O5.C6H6O3S/c1-22(2)20(30)28-19-13(34-22)6-7-16(27-19)26-18-12(23)10-24-21(29-18)25-11-8-14(31-3)17(33-5)15(9-11)32-4;7-10(8,9)6-4-2-1-3-5-6/h6-10H,1-5H3,(H3,24,25,26,27,28,29,30);1-5H,(H,7,8,9) |
InChIKey | UXDRJPYSTZHIOE-UHFFFAOYSA-N |
SMILES | CC1(C(=O)NC2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)C.C1=CC=C(C=C1)S(=O)(=O)O |
Reference | <p style=/line-height:25px/> |