For research use only. Not for therapeutic Use.
R803(Cat No.:I013317)is a promising antiviral compound under investigation for its potent inhibitory effects on hepatitis C virus (HCV) replication. As a non-nucleoside NS5B polymerase inhibitor, R803 specifically targets the RNA-dependent RNA polymerase essential for viral replication. Its unique mechanism of action and high selectivity make it effective against various HCV genotypes, including resistant strains. Preclinical studies highlight its favorable pharmacokinetic properties and potential for inclusion in combination therapies. R803 represents a significant step forward in developing advanced treatment strategies for chronic HCV infections.
Catalog Number | I013317 |
CAS Number | 67700-30-5 |
Molecular Formula | C₁₇H₁₄O₃ |
Purity | ≥95% |
Target | HCV |
Solubility | DMSO |
IUPAC Name | 2-(3-phenyl-1-benzofuran-7-yl)propanoic acid |
InChI | InChI=1S/C17H14O3/c1-11(17(18)19)13-8-5-9-14-15(10-20-16(13)14)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) |
InChIKey | ODZUWQAFWMLWCF-UHFFFAOYSA-N |
SMILES | CC(C1=CC=CC2=C1OC=C2C3=CC=CC=C3)C(=O)O |
Reference | [1]. Huang P, et al. Discovery and characterization of substituted diphenyl heterocyclic compounds as potent and selective inhibitors of hepatitis C virus replication. Antimicrob Agents Chemother. 2008 Apr;52(4):1419-29. |