For research use only. Not for therapeutic Use.
Rabeprazole (Cat No.:I000637) belongs to the class of second-generation proton pump inhibitors (PPIs), which are known for irreversibly blocking the activity of gastric H+/K+-ATPase. In addition to its PPI activity, Rabeprazole has been found to induce apoptosis. It also acts as an inhibitor of uridine nucleoside ribohydrolase (UNH) with an IC50 of 0.3 μM. Researchers can use Rabeprazole to study gastric ulcerations and gastroesophageal reflux.
| Catalog Number | I000637 |
| CAS Number | 117976-89-3 |
| Synonyms | 2-(((4-(3-methoxypropoxy)-3-methylpyridin-2-yl)methyl)sulfinyl)-1H-benzo[d]imidazole |
| Molecular Formula | C18H21N3O3S |
| Purity | ≥95% |
| Target | Proton Pump |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 2-[[4-(3-methoxypropoxy)-3-methylpyridin-2-yl]methylsulfinyl]-1H-benzimidazole |
| InChI | InChI=1S/C18H21N3O3S/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | YREYEVIYCVEVJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3N2)OCCCOC |
| Reference | <p style=/line-height:25px/> |
