For research use only. Not for therapeutic Use.
rac 5-Hydroxy valproic acid sodium salt (Cat No.:C000795) is a mixture of stereoisomers of the sodium salt of 5-hydroxy valproic acid, a derivative of valproic acid used as an anticonvulsant medication. With a 90% purity, this compound is likely a pharmaceutical intermediate or product impurity. The racemic mixture indicates a combination of both enantiomers. Researchers and pharmaceutical manufacturers might study this compound to understand its pharmacological effects, potential therapeutic applications, and influence on valproic acid metabolism.
| CAS Number | 78644-53-8 |
| Synonyms | 5-OH-VPA; 5-Hydroxy-2-propylpentanoic Acid; 2-Propyl-5-hydroxypentanoic Acid Sodium Salt; 2-n-Propyl-5-hydroxypentanoic Acid Sodium Salt; |
| Molecular Formula | C₈H₁₅NaO₃ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated), Water (Slightly, Sonica |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | sodium;5-hydroxy-2-propylpentanoate |
| InChI | InChI=1S/C8H16O3.Na/c1-2-4-7(8(10)11)5-3-6-9;/h7,9H,2-6H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | CSZWWXWOLIYBAB-UHFFFAOYSA-M |
| SMILES | CCCC(CCCO)C(=O)[O-].[Na+] |
| Reference | Burchell, B., et al.: Dev. Pharmacol. Ther., 13, 70 (1989), Bjorge, S.M., et al.: Drug Metab. Dispos., 19, 823 (1991), |
