For research use only. Not for therapeutic Use.
(Rac)-ABT-202 dihydrochloride is a racemate of ABT-202. ABT-202 is an agonist of nicotinic acetylcholine receptors (nAChRs) and can be used as an analgesic[1].
| Catalog Number | I017410 |
| CAS Number | 1258641-38-1 |
| Synonyms | 1-pyridin-3-ylpyrrolidin-3-amine;dihydrochloride |
| Molecular Formula | C9H15Cl2N3 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H13N3.2ClH/c10-8-3-5-12(7-8)9-2-1-4-11-6-9;;/h1-2,4,6,8H,3,5,7,10H2;2*1H |
| InChIKey | UPJISLUDXYKVQF-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C2=CN=CC=C2.Cl.Cl |
| Reference | [1]. Jain KK. Modulators of nicotinic acetylcholine receptors as analgesics. Curr Opin Investig Drugs. 2004 Jan;5(1):76-81. |
