For research use only. Not for therapeutic Use.
(rac)-Antineoplaston A10（Cat No.:I019001） refers to the racemic mixture of Antineoplaston A10. Antineoplaston A10 itself is a potential Ras inhibitor that holds promise for the treatment of various cancers, including glioma, lymphoma, astrocytoma, and breast cancer. Ras proteins are involved in regulating cell growth and proliferation, and their aberrant activation is often associated with cancer development. By inhibiting Ras, Antineoplaston A10 has the potential to impede tumor growth and serve as a therapeutic agent for these specific types of cancer.
| Catalog Number | I019001 |
| CAS Number | 77658-84-5 |
| Molecular Formula | C₁₃H₁₄N₂O₃ |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-phenylacetamide |
| InChI | InChI=1S/C13H14N2O3/c16-11-7-6-10(13(18)15-11)14-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,17)(H,15,16,18) |
| InChIKey | OQGRFQCUGLKSAV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)CC2=CC=CC=C2 |
| Reference | [1]. Qu XJ, et al. Induction of apoptosis in human hepatocellular carcinoma cells by synthetic antineoplaston A10. Anticancer Res. 2007 Jul-Aug;27(4B):2427-31. |
