For research use only. Not for therapeutic Use.
Potent Nek2 inhibitor (IC<sub>50</sub> = 73 nM). Exhibits selectivity for Nek2 over PLK1, MPS1, Cdk2 and Aurora A.
| Catalog Number | I010976 |
| CAS Number | 1364269-06-6 |
| Synonyms | 4-[2-Amino-5-[4-[(dimethylamino)methyl]-2-thienyl]-3-pyridinyl]-2-[[(2Z)-4,4,4-trifluoro-1-methyl-2-buten-1-yl]oxy]benzamide |
| Molecular Formula | C24H25F3N4O2S |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble to 100 mM in 1eq. HCl and to 100 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 4-[2-amino-5-[4-[(dimethylamino)methyl]thiophen-2-yl]pyridin-3-yl]-2-[(Z)-5,5,5-trifluoropent-3-en-2-yl]oxybenzamide |
| InChI | InChI=1S/C24H25F3N4O2S/c1-14(6-7-24(25,26)27)33-20-10-16(4-5-18(20)23(29)32)19-9-17(11-30-22(19)28)21-8-15(13-34-21)12-31(2)3/h4-11,13-14H,12H2,1-3H3,(H2,28,30)(H2,29,32)/b7-6- |
| InChIKey | LLEOOSLUHRQCHZ-SREVYHEPSA-N |
| SMILES | CC(C=CC(F)(F)F)OC1=C(C=CC(=C1)C2=C(N=CC(=C2)C3=CC(=CS3)CN(C)C)N)C(=O)N |
