For research use only. Not for therapeutic Use.
(Rac)-Cemsidomide（Cat No.:I043445）is a small molecule inhibitor that targets cereblon, a protein involved in regulating protein homeostasis through the ubiquitin-proteasome system. By binding to cereblon, (Rac)-Cemsidomide modulates the degradation of specific proteins that play a role in tumor cell survival and proliferation. This compound is being investigated for its potential therapeutic applications in cancer treatment, particularly in hematological malignancies such as multiple myeloma. (Rac)-Cemsidomide’s ability to induce selective protein degradation offers a promising approach for targeting cancer cells and overcoming resistance to existing therapies.
| CAS Number | 2504233-68-3 |
| Synonyms | 3-[6-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| Molecular Formula | C28H27N3O4 |
| Purity | ≥95% |
| IUPAC Name | 3-[6-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| InChI | InChI=1S/C28H27N3O4/c32-25-11-10-24(27(33)29-25)31-23-9-8-20(21-2-1-3-22(26(21)23)28(31)34)16-18-4-6-19(7-5-18)17-30-12-14-35-15-13-30/h1-9,24H,10-17H2,(H,29,32,33) |
| InChIKey | MUKCJOOKCZSQNW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C4C(=C(C=C3)CC5=CC=C(C=C5)CN6CCOCC6)C=CC=C4C2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
