For research use only. Not for therapeutic Use.
Racemic Cinacalcet-d3 Hydrochloride is a deuterated form of cinacalcet, a drug used to treat secondary hyperparathyroidism and other conditions associated with elevated parathyroid hormone levels. The three deuterium atoms replace hydrogen atoms in the molecule, providing a stable isotopic label for enhanced precision in pharmacokinetic and metabolic studies. This labeled compound allows for accurate tracking of the drug’s absorption, distribution, metabolism, and excretion. Its applications are significant in optimizing dosing regimens, studying drug interactions, and improving therapeutic strategies for managing disorders related to calcium and parathyroid hormone imbalances.
CAS Number | 1185097-33-9 |
Synonyms | α-(Methyl-d3)-N-[3-[3-(trifluoromethyl)phenyl)propyl]-1-napthalenemethanamine Hydrochloride; N-(3-(3-(trifluoromethyl)phenyl)propyl)-1-(1-napthyl)ethylamine-d3 Hydrochloride; |
Molecular Formula | C22H23ClF3N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(2,2,2-trideuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
InChI | InChI=1S/C22H22F3N.ClH/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;1H/i1D3; |
InChIKey | QANQWUQOEJZMLL-NIIDSAIPSA-N |
SMILES | [2H]C([2H])([2H])C(C1=CC=CC2=CC=CC=C21)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |