For research use only. Not for therapeutic Use.
rac-Cotinine-13C,d3 is a deuterated and carbon-13 labeled form of cotinine, featuring three deuterium atoms and one carbon-13 atom for enhanced stability and precision in research. This isotopically labeled compound is essential for studying the pharmacokinetics, metabolism, and biomarker analysis of nicotine exposure. rac-Cotinine-13C,d3 ensures reliable and consistent results in advanced pharmaceutical, toxicological, and clinical research, making it a valuable tool for scientists and healthcare professionals. Ideal for use in mass spectrometry and other analytical techniques, it supports accurate tracking and quantification in biological systems.
| CAS Number | 1215842-75-3 |
| Synonyms | (+/-)-1-(Methyl-13C,d3)-5-(2-pyridinyl)-2-pyrrolidinone; (+/-)-Cotinine-13C,d3; |
| Molecular Formula | C10H12N2O |
| Purity | ≥95% |
| Storage | Desiccate at +4 ℃ |
| IUPAC Name | 5-pyridin-3-yl-1-(trideuteriomethyl)pyrrolidin-2-one |
| InChI | InChI=1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/i1+1D3 |
| InChIKey | UIKROCXWUNQSPJ-KQORAOOSSA-N |
| SMILES | CN1C(CCC1=O)C2=CN=CC=C2 |
