For research use only. Not for therapeutic Use.
(Rac)-Cotinine-d4 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of (Rac)-Cotinine is crucial for studies involving nicotine metabolism, biomarker analysis, and pharmacokinetic profiling. Featuring four deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for toxicology research and drug development, (Rac)-Cotinine-d4 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S001022 |
CAS Number | 350818-68-7 |
Molecular Formula | C10H8D4N2O |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 1-methyl-5-(2,4,5,6-tetradeuteriopyridin-3-yl)pyrrolidin-2-one |
InChI | InChI=1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/i2D,3D,6D,7D |
InChIKey | UIKROCXWUNQSPJ-USSMZTJJSA-N |
SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCC(=O)N2C)[2H] |