rac Ketoprofen Amide-13C,d3 is a deuterated and carbon-13 labeled compound used in advanced pharmaceutical and biochemical research. Featuring a carbon-13 atom and three deuterium atoms, it provides enhanced stability and precision for isotopic labeling. This compound is ideal for mass spectrometry and nuclear magnetic resonance (NMR) studies, facilitating the investigation of metabolic pathways and drug interactions. Widely employed in pain management research, pharmacokinetic studies, and drug development, rac Ketoprofen Amide-13C,d3 ensures reliable and accurate analytical results, making it a crucial tool for scientists and researchers.
Catalog Number | R052387 |
CAS Number | 1346603-74-4 |
Synonyms | 3-Benzoyl-α-(methyl-13C,d3)benzeneacetamide; |
Molecular Formula | C16H15NO2 |
Purity | 0% |
Storage | -20°C |
IUPAC Name | 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanamide |
InChI | InChI=1S/C16H15NO2/c1-11(16(17)19)13-8-5-9-14(10-13)15(18)12-6-3-2-4-7-12/h2-11H,1H3,(H2,17,19)/i1+1D3 |
InChIKey | KLWMCJJRUWWDSW-KQORAOOSSA-N |
SMILES | CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)N |