For research use only. Not for therapeutic Use.
rac Matairesinol-d6 is a deuterated form of racemic matairesinol, where six hydrogen atoms are replaced with deuterium. This lignan compound is used as an internal standard in mass spectrometry and NMR spectroscopy, providing high precision in quantification and structural studies due to its stable isotope labeling. In pharmaceutical chemistry, it is essential for metabolic and pharmacokinetic studies, aiding in the research of lignan’s effects and potential therapeutic uses. In organic chemistry, it assists in reaction mechanism studies and isotope dilution analysis. Its deuterium content ensures accurate and reliable analytical results across various scientific fields.
CAS Number | 1346600-02-9 |
Synonyms | (3R,4R)-rel-Dihydro-3,4-bis[[4-hydroxy-3-methoxy(phenyl-d3)]methyl]-2(3H)-furanone; trans-Dihydro-3,4-bis[[4-hydroxy-3-methoxy(phenyl-d3)]methyl]-2(3H)-furanone; |
Molecular Formula | C20H22O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3S,4S)-3,4-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]oxolan-2-one |
InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m1/s1/i3D,4D,5D,6D,9D,10D |
InChIKey | MATGKVZWFZHCLI-NIQITUMISA-N |
SMILES | [2H]C1=C(C(=C(C(=C1C[C@@H]2COC(=O)[C@H]2CC3=C(C(=C(C(=C3[2H])[2H])O)OC)[2H])[2H])OC)O)[2H] |