For research use only. Not for therapeutic Use.
rac-Propranolol-d7 is a deuterated form of the beta-blocker propranolol, where seven hydrogen atoms are replaced with deuterium. This racemic mixture contains equal amounts of both enantiomers of propranolol. The deuterium labeling enhances its utility in pharmacokinetic and metabolic studies, allowing for precise tracking and differentiation in mass spectrometry and NMR spectroscopy. Despite the isotopic substitution, rac-Propranolol-d7 retains the same therapeutic properties as non-deuterated propranolol, making it valuable for research into the drug’s absorption, distribution, metabolism, and excretion.
CAS Number | 98897-23-5 |
Synonyms | 1-[(1-Methylethyl-d7)amino]-3-(1-naphthalenyloxy)-2-propanol; Avlocardyl-d7; Euprovasin-d7; Inderal; |
Molecular Formula | C16H21NO2 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | Room temperature |
IUPAC Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol |
InChI | InChI=1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3/i1D3,2D3,12D |
InChIKey | AQHHHDLHHXJYJD-QLWPOVNFSA-N |
SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O |