For research use only. Not for therapeutic Use.
(rac)-Rivastigmine-d6(Cat No.:S000309) is a deuterated form of rivastigmine, where six hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification is particularly useful as an analytical standard in techniques like mass spectrometry and NMR spectroscopy. Rivastigmine is a cholinesterase inhibitor used primarily for treating mild to moderate dementia associated with Alzheimer’s and Parkinson’s diseases.
Catalog Number | S000309 |
CAS Number | 194930-04-6 |
Molecular Formula | C14H16D6N2O2 |
Purity | ≥95% |
IUPAC Name | [3-[1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/i3D3,4D3 |
InChIKey | XSVMFMHYUFZWBK-LIJFRPJRSA-N |
SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)C(C)N(C)C |