For research use only. Not for therapeutic Use.
(Rac)-SHIN2 is a serine hydroxymethyltransferase (SHMT) inhibitor having 1,4-dihydropyrano[2,3-c]pyrazole structure. (Rac)-SHIN2 involves in folate or one-carbon metabolism pathways, prevents viral infection. SHMT1 and SHMT2 are the cytosolic and/or mitochondrial isoforms of serine hydroxymethyltransferase, respectively[1]. (Rac)-SHIN2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Catalog Number | I042658 |
| CAS Number | 2204289-53-0 |
| Synonyms | 6-amino-4-[3-(hydroxymethyl)-5-(5-hydroxypent-1-ynyl)phenyl]-3-methyl-4-propan-2-yl-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
| Molecular Formula | C23H26N4O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H26N4O3/c1-14(2)23(19(12-24)21(25)30-22-20(23)15(3)26-27-22)18-10-16(7-5-4-6-8-28)9-17(11-18)13-29/h9-11,14,28-29H,4,6,8,13,25H2,1-3H3,(H,26,27) |
| InChIKey | IWUCUJZMKDHLOF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)OC(=C(C2(C3=CC(=CC(=C3)C#CCCCO)CO)C(C)C)C#N)N |
| Reference | [1]. Mootha Vamsi, et al. Method of treating and preventing viral infection comprising inhibitors of folate or one-carbon metabolism pathways such as serine hydroxymethyltransferase inhibitors: World Intellectual Property Organization, WO2022120195[P]. 2022-06-09. |
