For research use only. Not for therapeutic Use.
rac-Terpinen-4-ol is a racemic mixture of Terpinen-4-ol, a naturally occurring monoterpene alcohol found in essential oils such as tea tree oil. Used in pharmaceutical, cosmetic, and biochemical research, it is known for its antimicrobial, anti-inflammatory, and antioxidant properties. This compound is essential for studying the therapeutic applications and biological activities of natural products. Researchers rely on rac-Terpinen-4-ol for precise and reliable results in advanced natural product chemistry, drug discovery, and skincare research, contributing significantly to innovations in health, wellness, and cosmetics.
| Catalog Number | R009908 |
| CAS Number | 562-74-3 |
| Synonyms | 4-Methyl-1-(1-methylethyl)-3-cyclohexen-1-ol; p-Menth-1-en-4-ol; (+/-)-4-Terpineol;?1-(1-Methylethyl)-4-methyl-3-cyclohexen-1-ol; 1-Terpinen-4-ol; 4-Carvomenthenol;?Melaleucol; NSC 147749; Terpin-4-ol; dl-4-Terpineol; ? |
| Molecular Formula | C10H18O |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 4-methyl-1-propan-2-ylcyclohex-3-en-1-ol |
| InChI | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
| InChIKey | WRYLYDPHFGVWKC-UHFFFAOYSA-N |
| SMILES | CC1=CCC(CC1)(C(C)C)O |
