For research use only. Not for therapeutic Use.
(Rac)-Upacicalcet is the racemate of Upacicalcet.Upacicalcet is an intravenous calcimimetic agent. Upacicalcet suppresses excessive parathyroid hormone (PTH) secretion, thereby lowering blood PTH levels, by acting directly on parathyroid cell membrane calcium-sensing receptors. Upacicalcet can be used for researching the disease of secondary hyperparathyroidism (SHPT)[1].
| Catalog Number | I043740 |
| CAS Number | 2649575-19-7 |
| Synonyms | 2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid |
| Molecular Formula | C11H14ClN3O6S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H14ClN3O6S/c1-5-7(12)2-6(22(19,20)21)3-9(5)15-11(18)14-4-8(13)10(16)17/h2-3,8H,4,13H2,1H3,(H,16,17)(H2,14,15,18)(H,19,20,21) |
| InChIKey | LHEYGVSDVBEYQF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)O)NC(=O)NCC(C(=O)O)N |
| Reference | [1]. Hoy SM. Upacicalcet: First Approval. Drugs. 2021;81(13):1593-1596. |
