For research use only. Not for therapeutic Use.
(Rac)-ZLc-002(Cat No.:I041429)is a small-molecule compound that acts as a selective inhibitor of the protein kinase ZAP-70 (zeta-chain-associated protein kinase 70), which is involved in T-cell receptor signaling and immune cell activation. By inhibiting ZAP-70, (Rac)-ZLc-002 can modulate immune responses, making it a potential therapeutic agent for autoimmune diseases, graft rejection, and certain cancers. The compound has been studied for its ability to suppress excessive immune activation and inflammation. Ongoing research is focused on understanding its pharmacological properties, safety profile, and therapeutic applications in immune-related conditions.
Synonyms | methyl 2-[(3-methoxy-3-oxopropanoyl)amino]-3-methylbutanoate |
Molecular Formula | C10H17NO5 |
Purity | ≥95% |
IUPAC Name | methyl 2-[(3-methoxy-3-oxopropanoyl)amino]-3-methylbutanoate |
InChI | InChI=1S/C10H17NO5/c1-6(2)9(10(14)16-4)11-7(12)5-8(13)15-3/h6,9H,5H2,1-4H3,(H,11,12) |
InChIKey | BWPKYDAJBOUZDX-UHFFFAOYSA-N |
SMILES | CC(C)C(C(=O)OC)NC(=O)CC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |