For research use only. Not for therapeutic Use.
Raclopride (Cat.No:I010466) is a selective dopamine D2 receptor antagonist commonly used in neuroscience research. As a radiotracer, it is employed in positron emission tomography (PET) studies to image and quantify dopamine receptor levels in the brain. Raclopride is valuable in investigating various neurological and psychiatric disorders, including schizophrenia and substance abuse.
| Catalog Number | I010466 |
| CAS Number | 84225-95-6 |
| Synonyms | 3,5-Dichloro-N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-2-hydroxy-6-methoxybenzamide |
| Molecular Formula | C15H20Cl2N2O3 |
| Purity | ≥95% |
| Target | Dopamine Receptor |
| Solubility | Soluble to 100 mM in DMSO and to 25 mM in ethanol |
| Storage | Store at RT |
| IUPAC Name | 3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-hydroxy-6-methoxybenzamide |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-3-19-6-4-5-9(19)8-18-15(21)12-13(20)10(16)7-11(17)14(12)22-2/h7,9,20H,3-6,8H2,1-2H3,(H,18,21)/t9-/m0/s1 |
| InChIKey | WAOQONBSWFLFPE-VIFPVBQESA-N |
| SMILES | CCN1CCCC1CNC(=O)C2=C(C(=CC(=C2OC)Cl)Cl)O |
