For research use only. Not for therapeutic Use.
Ractopamine-d6 Hydrochloride is a deuterated beta-adrenergic agonist used in advanced pharmaceutical and biochemical research. Incorporating six deuterium atoms, it offers enhanced stability and precise isotopic labeling for accurate analysis. This compound is ideal for mass spectrometry and nuclear magnetic resonance (NMR) studies, facilitating the investigation of metabolic pathways and drug interactions. Widely used in veterinary medicine, feed additives research, and residue analysis, Ractopamine-d6 Hydrochloride ensures reliable and accurate results, making it a valuable tool for scientists and researchers.
| Catalog Number | R006999 |
| CAS Number | 1276197-17-1 |
| Synonyms | 4-Hydroxy-α-[[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]methyl]benzene-?methanol-d6 Hydrochloride; |
| Molecular Formula | C18H24ClNO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[2,2,3,4,4,4-hexadeuterio-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol;hydrochloride |
| InChI | InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-8-16(20)9-5-14)19-12-18(22)15-6-10-17(21)11-7-15;/h4-11,13,18-22H,2-3,12H2,1H3;1H/i1D3,2D2,13D; |
| InChIKey | JHGSLSLUFMZUMK-RUUVDYPYSA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O.Cl |
