For research use only. Not for therapeutic Use.
Research chemical RAD140 (CAS 1182367-47-0), also known as Testolone, is a selective androgen receptor modulator (SARM) that is highly valued in research for its anabolic properties and minimal androgenic effects. It is designed to enhance muscle growth and strength while avoiding the adverse effects associated with traditional anabolic steroids. RAD140 is being investigated for its potential to treat muscle-wasting conditions, osteoporosis, and age-related muscle loss. Additionally, it shows promise in neuroprotection, making it a versatile compound in preclinical studies. Its targeted action and safety profile make RAD140 a critical tool in the development of therapeutic strategies.
| Catalog Number | I000022 |
| CAS Number | 1182367-47-0 |
| Synonyms | Testolone |
| Molecular Formula | C20H16ClN5O2 |
| Purity | ≥95% |
| Target | androgen receptor (AR) |
| Solubility | 10 mM in DMSO |
| Storage | Stored at -20°C. |
| IC50 | 7 nM (Ki, for androgen receptor) |
| IUPAC Name | 2-chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methylbenzonitrile |
| InChI | InChI=1S/C20H16ClN5O2/c1-11-16(8-7-15(10-23)17(11)21)24-18(12(2)27)20-26-25-19(28-20)14-5-3-13(9-22)4-6-14/h3-8,12,18,24,27H,1-2H3/t12-,18+/m0/s1 |
| InChIKey | XMBUPPIEVAFYHO-KPZWWZAWSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C#N)NC(C2=NN=C(O2)C3=CC=C(C=C3)C#N)C(C)O |
