For research use only. Not for therapeutic Use.
Radafaxine hydrochloride(Cat No.:I000308)is a selective serotonin-norepinephrine-dopamine reuptake inhibitor (SNDRI) that has been investigated as a potential treatment for disorders like depression, anxiety, and attention deficit hyperactivity disorder (ADHD). It works by increasing the levels of serotonin, norepinephrine, and dopamine in the brain, which are neurotransmitters involved in regulating mood, attention, and cognitive function. Radafaxine hydrochloride is still under clinical development and is being explored for its ability to improve mood, focus, and reduce symptoms of anxiety and depression. Its safety and efficacy in various mental health conditions are still being evaluated.
CAS Number | 106083-71-0 |
Molecular Formula | C13H19Cl2NO2 |
Purity | ≥95% |
Solubility | DMSO: ≥ 38 mg/mL |
Storage | Store at -20°C |
IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethylmorpholin-2-ol;hydrochloride |
InChI | InChI=1S/C13H18ClNO2.ClH/c1-9-13(16,17-8-12(2,3)15-9)10-5-4-6-11(14)7-10;/h4-7,9,15-16H,8H2,1-3H3;1H/t9-,13+;/m0./s1 |
InChIKey | ORXTVTDGPVINDN-BTJVGWIPSA-N |
SMILES | C[C@H]1[C@@](OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O.Cl |
Reference | <p style=/line-height:25px/> |