For research use only. Not for therapeutic Use.
Radicinin（Cat No.:M121499） is a natural product isolated from the fungus Alternaria chrysanthemi. It is a polyketide derivative with potential biological activities. Radicinin has been studied for its antifungal properties against plant pathogens and its potential as a biopesticide. Additionally, it has shown inhibitory effects on protein kinases, suggesting potential therapeutic applications in cancer treatment. Radicinin’s mechanism of action involves interference with signal transduction pathways, particularly those involved in cell growth and proliferation.
| Catalog Number | M121499 |
| CAS Number | 10088-95-6 |
| Molecular Formula | C12H12O5 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | (2S,3S)-3-hydroxy-2-methyl-7-[(E)-prop-1-enyl]-2,3-dihydropyrano[3,2-c]pyran-4,5-dione |
| InChI | InChI=1S/C12H12O5/c1-3-4-7-5-8-9(12(15)17-7)11(14)10(13)6(2)16-8/h3-6,10,13H,1-2H3/b4-3+/t6-,10-/m0/s1 |
| InChIKey | SDKXGAICTNHFCN-DCJAWTJCSA-N |
| SMILES | CC=CC1=CC2=C(C(=O)C(C(O2)C)O)C(=O)O1 |
