For research use only. Not for therapeutic Use.
<p style=/line-height:25px/>RAF709 is a novel Raf kinase inhibitor extracted from patent WO2014151616A1, compound example 131, has an IC50 of 0.5 and 1.8 nM for c-Raf and b-Raf, respectively.<br>IC50 & Target: 0.5 nM (c-Raf), 1.8 nM (b-Raf)[1]<br>InVitro: The invention provides compounds (e.g., RAF709) that inhibit Raf kinases, and are accordingly useful for treating certain disorders associated with excessive Raf kinase activity, including cell proliferation disorders such as cancers[1].</p>
| Catalog Number | I002108 |
| CAS Number | 1628838-42-5 |
| Molecular Formula | C28H29F3N4O4 |
| Purity | ≥95% |
| Target | Raf |
| Solubility | DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C28H29F3N4O4/c1-18-24(15-22(17-32-18)34-26(36)19-3-2-4-21(13-19)28(29,30)31)20-14-25(35-7-11-38-12-8-35)27(33-16-20)39-23-5-9-37-10-6-23/h2-4,13-17,23H,5-12H2,1H3,(H,34,36) |
| InChIKey | FYNMINFUAIDIFL-UHFFFAOYSA-N |
| SMILES | O=C(NC1=CN=C(C)C(C2=CC(N3CCOCC3)=C(OC4CCOCC4)N=C2)=C1)C5=CC(C(F)(F)F)=CC=C5 |
| Reference | <p style=/line-height:25px/> |
