For research use only. Not for therapeutic Use.
Raloxifene Hydrochloride(CAT: A001074) is a selective estrogen receptor modulator (SERM) that exhibits tissue-specific estrogenic and anti-estrogenic effects. It acts as an estrogen agonist in bone, promoting bone density, and as an antagonist in breast and uterine tissues, reducing the risk of hormone-dependent cancers. This compound is particularly valuable in endocrinology and oncology research, supporting studies on osteoporosis, breast cancer prevention, and hormone signaling. Raloxifene Hydrochloride is a crucial tool for exploring the therapeutic potential of SERMs in bone health and estrogen-related disorders, contributing to advancements in drug discovery and personalized medicine.
CAS Number | 82640-04-8 |
Synonyms | LY156758 (Keoxifene) HCl; LY156758 hydrochloride |
Molecular Formula | C28H27NO4S ? HCl |
Purity | ≥95% |
Target | Autophagy |
Solubility | 10 mM in DMSO |
Storage | 3 years -20°C powder |
IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone;hydrochloride |
InChI | InChI=1S/C28H27NO4S.ClH/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29;/h4-13,18,30-31H,1-3,14-17H2;1H |
InChIKey | BKXVVCILCIUCLG-UHFFFAOYSA-N |
SMILES | OC1=CC=C(C(C(C2=CC=C(OCCN3CCCCC3)C=C2)=O)=C(C4=CC=C(O)C=C4)S5)C5=C1.Cl |