For research use only. Not for therapeutic Use.
Ramelteon-d3（Cat No.:S000481）, a premium pharmaceutical research compound designed for advanced sleep disorder studies. As a deuterated analog of Ramelteon, it offers enhanced stability and improved pharmacokinetic properties. Ramelteon-d3 is ideal for use in pharmacological and biochemical research, providing precise and reliable data for your studies. This high-purity compound ensures consistent results, aiding in the development of novel therapies for insomnia and other sleep disorders. Trusted by leading laboratories, Ramelteon-d3 is your go-to solution for cutting-edge sleep research.
| Catalog Number | S000481 |
| CAS Number | 1432057-38-9 |
| Molecular Formula | C16H18D3NO2 |
| Purity | ≥95% |
| IUPAC Name | 3,3,3-trideuterio-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChI | InChI=1S/C16H21NO2/c1-2-15(18)17-9-7-12-4-3-11-5-6-14-13(16(11)12)8-10-19-14/h5-6,12H,2-4,7-10H2,1H3,(H,17,18)/t12-/m0/s1/i1D3 |
| InChIKey | YLXDSYKOBKBWJQ-JHFOHIRNSA-N |
| SMILES | CCC(=O)NCCC1CCC2=C1C3=C(C=C2)OCC3 |
