For research use only. Not for therapeutic Use.
Ramosetron Hydrochloride(YM060 Hydrochloride) is a serotonin 5-HT3 receptor antagonist for the treatment of nausea and vomiting.
Target: 5-HT3 Receptor
Ramosetron hydrochloride selectively blocks serotonin receptors (5-HT3). Serotonin plays a vital role in vomiting, serotonin-induced bradycardic reflex and peristalsis. The pharmacological action of Ramosetron hydrochloride is sustained and potent.
| Catalog Number | I008975 |
| CAS Number | 132907-72-3 |
| Synonyms | (1-methylindol-3-yl)-[(5R)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone;hydrochloride |
| Molecular Formula | C17H18ClN3O |
| Purity | ≥95% |
| InChI | InChI=1S/C17H17N3O.ClH/c1-20-9-13(12-4-2-3-5-16(12)20)17(21)11-6-7-14-15(8-11)19-10-18-14;/h2-5,9-11H,6-8H2,1H3,(H,18,19);1H/t11-;/m1./s1 |
| InChIKey | XIXYTCLDXQRHJO-RFVHGSKJSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C3CCC4=C(C3)NC=N4.Cl |
| Reference | [1]. http://www.drugsupdate.com/generic/view/1111 |
