For research use only. Not for therapeutic Use.
Randialic acid B, a triterpenoid compound, is a formyl peptide receptor 1 (FPR1) antagonist. Randialic acid B blocks FPR1 in human neutrophils and attenuates psoriasis-like inflammation in vivo[1].
Randialic acid B (0.1-3 μM; for 5 min) selectively inhibits reactive oxygen species production, elastase release, and CD11b expression in human neutrophils activated by FPR1. Randialic acid B inhibits the binding of N-formyl peptide to FPR1 in human neutrophils, neutrophil-like THP-1 cells, and hFPR1-transfected HEK293 cells, indicating FPR1 antagonism[1].
Randialic acid B acts competitively for its binding to the FPR1 receptor. The FPR1-downstream signaling such as Ca2+ mobilisation and activation of Akt and MAPKs is also competitively inhibited[1].
Randialic acid B shows significant cell-protective effects against H2O2-induced H9c2 cardiomyocyte injury[2].
Randialic acid B (10 mg/kg; i.v.; every other day; for 5 days) significantly reduces Imiquimod-induced psoriasis-like symptom, including epidermal hyperplasia, desquamation with scaling, neutrophil skin infiltration, and transepidermal water loss[1].
| Catalog Number | I044829 |
| CAS Number | 14021-14-8 |
| Synonyms | (2R,4aS,6aR,6aS,6bR,8aR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,10,11,12,13-dodecahydro-2H-picene-4a-carboxylic acid |
| Molecular Formula | C30H46O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18,21-23,31H,9-17H2,1-7H3,(H,32,33)/t18-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
| InChIKey | GPQBTLJRTQXVOM-UORVSENQSA-N |
| SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2=C1C)C)C(=O)O |
| Reference | [1]. Michal Korinek, et al. Randialic acid B and tomentosolic acid block formyl peptide receptor 1 in human neutrophils and attenuate psoriasis-like inflammation in vivo. Biochem Pharmacol. 2021 Aug;190:114596. [2]. Shan-Shan Li, et al. Three new triterpenoids isolated from the aerial parts of Ilex cornuta and protective effects against H 2 O 2-induced myocardial cell injury. Chin J Nat Med. 2017 Feb;15(2):115-120. |
