For research use only. Not for therapeutic Use.
Ranitidine-d6 hydrochloride（Cat No.:S000337） is a deuterated version of ranitidine hydrochloride, where six hydrogen atoms are replaced with deuterium. Ranitidine is a histamine H2-receptor antagonist used to reduce stomach acid production, treating conditions like peptic ulcers and gastroesophageal reflux disease (GERD). Deuteration enhances ranitidine’s molecular stability, enabling more precise pharmacokinetic and metabolic studies. These enhanced studies provide deeper insights into the drug’s absorption, distribution, metabolism, and excretion processes.
| Catalog Number | S000337 |
| CAS Number | 1185238-09-8 |
| Molecular Formula | C13H17D6ClN4O3S |
| Purity | ≥95% |
| IUPAC Name | (E)-1-N'-[2-[[5-[[bis(trideuteriomethyl)amino]methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;hydrochloride |
| InChI | InChI=1S/C13H22N4O3S.ClH/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;/h4-5,9,14-15H,6-8,10H2,1-3H3;1H/b13-9+;/i2D3,3D3; |
| InChIKey | GGWBHVILAJZWKJ-DICWLCDHSA-N |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCC1=CC=C(O1)CN(C)C.Cl |
